C25H37N — CID 90146996
(4E,6E)-5-ethenyl-6-[(2R)-2-ethenylcyclohex-3-en-1-yl]-N-[(3Z)-hepta-1,3-dien-2-yl]octa-4,6-dien-2-amine (PubChem CID 90146996) has the molecular formula C25H37N and a molecular weight of 351.58 g/mol. Its IUPAC name is (4E,6E)-5-ethenyl-6-[(2R)-2-ethenylcyclohex-3-en-1-yl]-N-[(3Z)-hepta-1,3-dien-2-yl]octa-4,6-dien-2-amine.
| Compound Name | (4E,6E)-5-ethenyl-6-[(2R)-2-ethenylcyclohex-3-en-1-yl]-N-[(3Z)-hepta-1,3-dien-2-yl]octa-4,6-dien-2-amine |
|---|---|
| PubChem CID | 90146996 |
| Molecular Formula | C25H37N |
| Molecular Weight | 351.58 g/mol |
| Exact Mass | 351.29 |
| IUPAC Name | (4E,6E)-5-ethenyl-6-[(2R)-2-ethenylcyclohex-3-en-1-yl]-N-[(3Z)-hepta-1,3-dien-2-yl]octa-4,6-dien-2-amine |
| SMILES | C=CC(=C\CC(C)NC(=C)/C=C\CCC)/C(=C/C)C1CCC=C[C@H]1C=C |
| InChI | InChI=1S/C25H37N/c1-7-11-12-15-20(5)26-21(6)18-19-23(9-3)24(10-4)25-17-14-13-16-22(25)8-2/h8-10,12-13,15-16,19,21-22,25-26H,2-3,5,7,11,14,17-18H2,1,4,6H3/b15-12-,23-19+,24-10-/t21?,22-,25?/m1/s1 |
| InChIKey | JPYZDZUYWPSEQM-ADZUDPKQSA-N |
| XLogP | 7.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.58 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|