C17H25F2N3O2 — CID 90147184
1-[(2R,3R,4S)-2-azido-4-butoxy-5,5-difluoro-3-methoxypentan-2-yl]-2-methylbenzene (PubChem CID 90147184) has the molecular formula C17H25F2N3O2 and a molecular weight of 341.40 g/mol. Its IUPAC name is 1-[(2R,3R,4S)-2-azido-4-butoxy-5,5-difluoro-3-methoxypentan-2-yl]-2-methylbenzene.
| Compound Name | 1-[(2R,3R,4S)-2-azido-4-butoxy-5,5-difluoro-3-methoxypentan-2-yl]-2-methylbenzene |
|---|---|
| PubChem CID | 90147184 |
| Molecular Formula | C17H25F2N3O2 |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 1-[(2R,3R,4S)-2-azido-4-butoxy-5,5-difluoro-3-methoxypentan-2-yl]-2-methylbenzene |
| SMILES | CCCCO[C@H](C(F)F)[C@H](OC)[C@](C)(N=[N+]=[N-])c1ccccc1C |
| InChI | InChI=1S/C17H25F2N3O2/c1-5-6-11-24-14(16(18)19)15(23-4)17(3,21-22-20)13-10-8-7-9-12(13)2/h7-10,14-16H,5-6,11H2,1-4H3/t14-,15-,17+/m0/s1 |
| InChIKey | MCBYOJJMPDUJOP-YQQAZPJKSA-N |
| XLogP | 4.99 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|