C21H25FO5S — CID 90147589
[3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(2-fluorophenyl)propyl] 4-methylbenzenesulfonate (PubChem CID 90147589) has the molecular formula C21H25FO5S and a molecular weight of 408.49 g/mol. Its IUPAC name is [3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(2-fluorophenyl)propyl] 4-methylbenzenesulfonate.
| Compound Name | [3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(2-fluorophenyl)propyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 90147589 |
| Molecular Formula | C21H25FO5S |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | [3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(2-fluorophenyl)propyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCC(c2ccccc2F)[C@@H]2COC(C)(C)O2)cc1 |
| InChI | InChI=1S/C21H25FO5S/c1-15-8-10-16(11-9-15)28(23,24)26-13-12-18(17-6-4-5-7-19(17)22)20-14-25-21(2,3)27-20/h4-11,18,20H,12-14H2,1-3H3/t18?,20-/m0/s1 |
| InChIKey | PJYHTPPKPXYZGD-IJHRGXPZSA-N |
| XLogP | 4.16 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|