C11H14F9NO3 — CID 90147942
2,4-dihydroxy-3,3-dimethyl-N-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)butanamide (PubChem CID 90147942) has the molecular formula C11H14F9NO3 and a molecular weight of 379.22 g/mol. Its IUPAC name is 2,4-dihydroxy-3,3-dimethyl-N-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)butanamide.
| Compound Name | 2,4-dihydroxy-3,3-dimethyl-N-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)butanamide |
|---|---|
| PubChem CID | 90147942 |
| Molecular Formula | C11H14F9NO3 |
| Molecular Weight | 379.22 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 2,4-dihydroxy-3,3-dimethyl-N-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)butanamide |
| SMILES | CC(C)(CO)C(O)C(=O)NCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H14F9NO3/c1-7(2,4-22)5(23)6(24)21-3-8(12,13)9(14,15)10(16,17)11(18,19)20/h5,22-23H,3-4H2,1-2H3,(H,21,24) |
| InChIKey | BKGWPUWGHAHNLI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.22 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|