C7H10O4 — CID 90148022
(3E,5Z)-hepta-1,3,5-triene-2,3,5,6-tetrol (PubChem CID 90148022) has the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. Its IUPAC name is (3E,5Z)-hepta-1,3,5-triene-2,3,5,6-tetrol.
| Compound Name | (3E,5Z)-hepta-1,3,5-triene-2,3,5,6-tetrol |
|---|---|
| PubChem CID | 90148022 |
| Molecular Formula | C7H10O4 |
| Molecular Weight | 158.15 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | (3E,5Z)-hepta-1,3,5-triene-2,3,5,6-tetrol |
| SMILES | C=C(O)/C(O)=C\C(O)=C(/C)O |
| InChI | InChI=1S/C7H10O4/c1-4(8)6(10)3-7(11)5(2)9/h3,8-11H,1H2,2H3/b6-3+,7-5- |
| InChIKey | NAFUKSIRWZIAGT-MZECIPTHSA-N |
| XLogP | 1.85 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.15 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|