C24H32O6 — CID 90148028
[(E)-[(1R,4aS,6Z,11aR)-1-acetyloxy-7-methyl-4-(4-methylpent-3-enoyl)-4a,5,8,9,10,11a-hexahydro-1H-cyclonona[c]pyran-11-ylidene]methyl] acetate (PubChem CID 90148028) has the molecular formula C24H32O6 and a molecular weight of 416.51 g/mol. Its IUPAC name is [(E)-[(1R,4aS,6Z,11aR)-1-acetyloxy-7-methyl-4-(4-methylpent-3-enoyl)-4a,5,8,9,10,11a-hexahydro-1H-cyclonona[c]pyran-11-ylidene]methyl] acetate.
| Compound Name | [(E)-[(1R,4aS,6Z,11aR)-1-acetyloxy-7-methyl-4-(4-methylpent-3-enoyl)-4a,5,8,9,10,11a-hexahydro-1H-cyclonona[c]pyran-11-ylidene]methyl] acetate |
|---|---|
| PubChem CID | 90148028 |
| Molecular Formula | C24H32O6 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | [(E)-[(1R,4aS,6Z,11aR)-1-acetyloxy-7-methyl-4-(4-methylpent-3-enoyl)-4a,5,8,9,10,11a-hexahydro-1H-cyclonona[c]pyran-11-ylidene]methyl] acetate |
| SMILES | CC(=O)O/C=C1\CCC/C(C)=C\C[C@@H]2C(C(=O)CC=C(C)C)=CO[C@H](OC(C)=O)[C@@H]12 |
| InChI | InChI=1S/C24H32O6/c1-15(2)9-12-22(27)21-14-29-24(30-18(5)26)23-19(13-28-17(4)25)8-6-7-16(3)10-11-20(21)23/h9-10,13-14,20,23-24H,6-8,11-12H2,1-5H3/b16-10-,19-13+/t20-,23+,24-/m1/s1 |
| InChIKey | CMXJDONMNDTCBZ-ORAJINCFSA-N |
| XLogP | 4.91 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|