C18H22N2O5S — CID 90148315
dimethyl (3S,7R,7aR)-6-benzyl-2,2-dimethyl-5-oxo-7,7a-dihydro-3H-imidazo[5,1-b][1,3]thiazole-3,7-dicarboxylate (PubChem CID 90148315) has the molecular formula C18H22N2O5S and a molecular weight of 378.45 g/mol. Its IUPAC name is dimethyl (3S,7R,7aR)-6-benzyl-2,2-dimethyl-5-oxo-7,7a-dihydro-3H-imidazo[5,1-b][1,3]thiazole-3,7-dicarboxylate.
| Compound Name | dimethyl (3S,7R,7aR)-6-benzyl-2,2-dimethyl-5-oxo-7,7a-dihydro-3H-imidazo[5,1-b][1,3]thiazole-3,7-dicarboxylate |
|---|---|
| PubChem CID | 90148315 |
| Molecular Formula | C18H22N2O5S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | dimethyl (3S,7R,7aR)-6-benzyl-2,2-dimethyl-5-oxo-7,7a-dihydro-3H-imidazo[5,1-b][1,3]thiazole-3,7-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2SC(C)(C)[C@H](C(=O)OC)N2C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C18H22N2O5S/c1-18(2)13(16(22)25-4)20-14(26-18)12(15(21)24-3)19(17(20)23)10-11-8-6-5-7-9-11/h5-9,12-14H,10H2,1-4H3/t12-,13-,14+/m0/s1 |
| InChIKey | UVECPWFRXLGIMJ-MELADBBJSA-N |
| XLogP | 1.86 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |