About (9aS)-2-bromo-7-iodo-9,9-dimethyl-1,9a-dihydrofluorene
(9aS)-2-bromo-7-iodo-9,9-dimethyl-1,9a-dihydrofluorene (PubChem CID 90148514) has the molecular formula C15H14BrI
and a molecular weight of 401.09 g/mol. Its IUPAC name is (9aS)-2-bromo-7-iodo-9,9-dimethyl-1,9a-dihydrofluorene.
Molecular Properties
| Compound Name | (9aS)-2-bromo-7-iodo-9,9-dimethyl-1,9a-dihydrofluorene |
| PubChem CID | 90148514 |
| Molecular Formula | C15H14BrI |
| Molecular Weight | 401.09 g/mol |
| Exact Mass | 399.93 |
| IUPAC Name | (9aS)-2-bromo-7-iodo-9,9-dimethyl-1,9a-dihydrofluorene |
| SMILES | CC1(C)c2cc(I)ccc2C2=CC=C(Br)C[C@H]21 |
| InChI | InChI=1S/C15H14BrI/c1-15(2)13-7-9(16)3-5-11(13)12-6-4-10(17)8-14(12)15/h3-6,8,13H,7H2,1-2H3/t13-/m1/s1 |
| InChIKey | ZVMQEANJOLVJPT-CYBMUJFWSA-N |
| XLogP | 5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.09 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (9aS)-2-bromo-7-iodo-9,9-dimethyl-1,9a-dihydrofluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9aS)-2-bromo-7-iodo-9,9-dimethyl-1,9a-dihydrofluorene?
The IUPAC name of (9aS)-2-bromo-7-iodo-9,9-dimethyl-1,9a-dihydrofluorene (CID 90148514) is (9aS)-2-bromo-7-iodo-9,9-dimethyl-1,9a-dihydrofluorene.
What is the SMILES notation for (9aS)-2-bromo-7-iodo-9,9-dimethyl-1,9a-dihydrofluorene?
The canonical SMILES for (9aS)-2-bromo-7-iodo-9,9-dimethyl-1,9a-dihydrofluorene is CC1(C)c2cc(I)ccc2C2=CC=C(Br)C[C@H]21.
What is the InChIKey of (9aS)-2-bromo-7-iodo-9,9-dimethyl-1,9a-dihydrofluorene?
The InChIKey is ZVMQEANJOLVJPT-CYBMUJFWSA-N. The full InChI is InChI=1S/C15H14BrI/c1-15(2)13-7-9(16)3-5-11(13)12-6-4-10(17)8-14(12)15/h3-6,8,13H,7H2,1-2H3/t13-/m1/s1.
What are the key properties of (9aS)-2-bromo-7-iodo-9,9-dimethyl-1,9a-dihydrofluorene?
(9aS)-2-bromo-7-iodo-9,9-dimethyl-1,9a-dihydrofluorene has a molecular weight of 401.09 g/mol, XLogP of 5.26, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (9aS)-2-bromo-7-iodo-9,9-dimethyl-1,9a-dihydrofluorene is sourced from PubChem (CID 90148514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).