C20H24N2O2S — CID 90148804
N-[(1R,9R,13S)-4-hydroxy-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]-N-methylthiophene-3-carboxamide (PubChem CID 90148804) has the molecular formula C20H24N2O2S and a molecular weight of 356.49 g/mol. Its IUPAC name is N-[(1R,9R,13S)-4-hydroxy-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]-N-methylthiophene-3-carboxamide.
| Compound Name | N-[(1R,9R,13S)-4-hydroxy-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]-N-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 90148804 |
| Molecular Formula | C20H24N2O2S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | N-[(1R,9R,13S)-4-hydroxy-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]-N-methylthiophene-3-carboxamide |
| SMILES | CN1CC[C@]2(C)c3cc(O)ccc3C[C@@H]1[C@H]2N(C)C(=O)c1ccsc1 |
| InChI | InChI=1S/C20H24N2O2S/c1-20-7-8-21(2)17(10-13-4-5-15(23)11-16(13)20)18(20)22(3)19(24)14-6-9-25-12-14/h4-6,9,11-12,17-18,23H,7-8,10H2,1-3H3/t17-,18-,20-/m1/s1 |
| InChIKey | YEMIHKTWEGYKSH-QWFCFKBJSA-N |
| XLogP | 3.11 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |