C27H34N4O2 — CID 90148818
4-[[[(1R,13S)-10-(cyclopropylmethyl)-1,4-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]-methylcarbamoyl]amino]benzamide (PubChem CID 90148818) has the molecular formula C27H34N4O2 and a molecular weight of 446.60 g/mol. Its IUPAC name is 4-[[[(1R,13S)-10-(cyclopropylmethyl)-1,4-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]-methylcarbamoyl]amino]benzamide.
| Compound Name | 4-[[[(1R,13S)-10-(cyclopropylmethyl)-1,4-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]-methylcarbamoyl]amino]benzamide |
|---|---|
| PubChem CID | 90148818 |
| Molecular Formula | C27H34N4O2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | 4-[[[(1R,13S)-10-(cyclopropylmethyl)-1,4-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]-methylcarbamoyl]amino]benzamide |
| SMILES | Cc1ccc2c(c1)[C@@]1(C)CCN(CC3CC3)C(C2)[C@H]1N(C)C(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C27H34N4O2/c1-17-4-7-20-15-23-24(27(2,22(20)14-17)12-13-31(23)16-18-5-6-18)30(3)26(33)29-21-10-8-19(9-11-21)25(28)32/h4,7-11,14,18,23-24H,5-6,12-13,15-16H2,1-3H3,(H2,28,32)(H,29,33)/t23?,24-,27-/m1/s1 |
| InChIKey | HOHLPAYJVKOXFN-XBAMXDLOSA-N |
| XLogP | 3.92 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |