About 2-(1-methylcyclohexa-2,4-dien-1-yl)acetaldehyde
2-(1-methylcyclohexa-2,4-dien-1-yl)acetaldehyde (PubChem CID 90148983) has the molecular formula C9H12O
and a molecular weight of 136.19 g/mol. Its IUPAC name is 2-(1-methylcyclohexa-2,4-dien-1-yl)acetaldehyde.
Molecular Properties
| Compound Name | 2-(1-methylcyclohexa-2,4-dien-1-yl)acetaldehyde |
| PubChem CID | 90148983 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | 2-(1-methylcyclohexa-2,4-dien-1-yl)acetaldehyde |
| SMILES | CC1(CC=O)C=CC=CC1 |
| InChI | InChI=1S/C9H12O/c1-9(7-8-10)5-3-2-4-6-9/h2-5,8H,6-7H2,1H3 |
| InChIKey | ZBXZJWPLSZFQEK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-methylcyclohexa-2,4-dien-1-yl)acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methylcyclohexa-2,4-dien-1-yl)acetaldehyde?
The IUPAC name of 2-(1-methylcyclohexa-2,4-dien-1-yl)acetaldehyde (CID 90148983) is 2-(1-methylcyclohexa-2,4-dien-1-yl)acetaldehyde.
What is the SMILES notation for 2-(1-methylcyclohexa-2,4-dien-1-yl)acetaldehyde?
The canonical SMILES for 2-(1-methylcyclohexa-2,4-dien-1-yl)acetaldehyde is CC1(CC=O)C=CC=CC1.
What is the InChIKey of 2-(1-methylcyclohexa-2,4-dien-1-yl)acetaldehyde?
The InChIKey is ZBXZJWPLSZFQEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O/c1-9(7-8-10)5-3-2-4-6-9/h2-5,8H,6-7H2,1H3.
What are the key properties of 2-(1-methylcyclohexa-2,4-dien-1-yl)acetaldehyde?
2-(1-methylcyclohexa-2,4-dien-1-yl)acetaldehyde has a molecular weight of 136.19 g/mol, XLogP of 2.10, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methylcyclohexa-2,4-dien-1-yl)acetaldehyde is sourced from PubChem (CID 90148983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).