C24H26N6O2S — CID 90149109
N-[(1S)-7-(methylamino)-7-oxo-1-(5-quinolin-7-yl-1H-imidazol-2-yl)heptyl]-1,3-thiazole-5-carboxamide (PubChem CID 90149109) has the molecular formula C24H26N6O2S and a molecular weight of 462.58 g/mol. Its IUPAC name is N-[(1S)-7-(methylamino)-7-oxo-1-(5-quinolin-7-yl-1H-imidazol-2-yl)heptyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(1S)-7-(methylamino)-7-oxo-1-(5-quinolin-7-yl-1H-imidazol-2-yl)heptyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 90149109 |
| Molecular Formula | C24H26N6O2S |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | N-[(1S)-7-(methylamino)-7-oxo-1-(5-quinolin-7-yl-1H-imidazol-2-yl)heptyl]-1,3-thiazole-5-carboxamide |
| SMILES | CNC(=O)CCCCC[C@H](NC(=O)c1cncs1)c1ncc(-c2ccc3cccnc3c2)[nH]1 |
| InChI | InChI=1S/C24H26N6O2S/c1-25-22(31)8-4-2-3-7-18(30-24(32)21-14-26-15-33-21)23-28-13-20(29-23)17-10-9-16-6-5-11-27-19(16)12-17/h5-6,9-15,18H,2-4,7-8H2,1H3,(H,25,31)(H,28,29)(H,30,32)/t18-/m0/s1 |
| InChIKey | KZAHLEHIMLMLJK-SFHVURJKSA-N |
| XLogP | 4.25 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|