C21H24N8O2S — CID 90149126
N-[(1S)-1-[5-(2H-benzotriazol-5-yl)-1H-imidazol-2-yl]-7-(methylamino)-7-oxoheptyl]-1,3-thiazole-5-carboxamide (PubChem CID 90149126) has the molecular formula C21H24N8O2S and a molecular weight of 452.54 g/mol. Its IUPAC name is N-[(1S)-1-[5-(2H-benzotriazol-5-yl)-1H-imidazol-2-yl]-7-(methylamino)-7-oxoheptyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(1S)-1-[5-(2H-benzotriazol-5-yl)-1H-imidazol-2-yl]-7-(methylamino)-7-oxoheptyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 90149126 |
| Molecular Formula | C21H24N8O2S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | N-[(1S)-1-[5-(2H-benzotriazol-5-yl)-1H-imidazol-2-yl]-7-(methylamino)-7-oxoheptyl]-1,3-thiazole-5-carboxamide |
| SMILES | CNC(=O)CCCCC[C@H](NC(=O)c1cncs1)c1ncc(-c2ccc3n[nH]nc3c2)[nH]1 |
| InChI | InChI=1S/C21H24N8O2S/c1-22-19(30)6-4-2-3-5-15(26-21(31)18-11-23-12-32-18)20-24-10-17(25-20)13-7-8-14-16(9-13)28-29-27-14/h7-12,15H,2-6H2,1H3,(H,22,30)(H,24,25)(H,26,31)(H,27,28,29)/t15-/m0/s1 |
| InChIKey | DJBFEKVYYHLZHK-HNNXBMFYSA-N |
| XLogP | 2.97 |
| TPSA | 141.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|