C27H29N5O2S — CID 90149248
N-[(1S)-7-(methylamino)-7-oxo-1-[5-(4-phenylphenyl)-1H-imidazol-2-yl]heptyl]-1,3-thiazole-5-carboxamide (PubChem CID 90149248) has the molecular formula C27H29N5O2S and a molecular weight of 487.63 g/mol. Its IUPAC name is N-[(1S)-7-(methylamino)-7-oxo-1-[5-(4-phenylphenyl)-1H-imidazol-2-yl]heptyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(1S)-7-(methylamino)-7-oxo-1-[5-(4-phenylphenyl)-1H-imidazol-2-yl]heptyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 90149248 |
| Molecular Formula | C27H29N5O2S |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | N-[(1S)-7-(methylamino)-7-oxo-1-[5-(4-phenylphenyl)-1H-imidazol-2-yl]heptyl]-1,3-thiazole-5-carboxamide |
| SMILES | CNC(=O)CCCCC[C@H](NC(=O)c1cncs1)c1ncc(-c2ccc(-c3ccccc3)cc2)[nH]1 |
| InChI | InChI=1S/C27H29N5O2S/c1-28-25(33)11-7-3-6-10-22(32-27(34)24-17-29-18-35-24)26-30-16-23(31-26)21-14-12-20(13-15-21)19-8-4-2-5-9-19/h2,4-5,8-9,12-18,22H,3,6-7,10-11H2,1H3,(H,28,33)(H,30,31)(H,32,34)/t22-/m0/s1 |
| InChIKey | AVLDRTSLBWHKLU-QFIPXVFZSA-N |
| XLogP | 5.37 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|