C8H15Br2N3OSi — CID 90149322
2-[(3,5-dibromo-1,2,4-triazol-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 90149322) has the molecular formula C8H15Br2N3OSi and a molecular weight of 357.12 g/mol. Its IUPAC name is 2-[(3,5-dibromo-1,2,4-triazol-1-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(3,5-dibromo-1,2,4-triazol-1-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 90149322 |
| Molecular Formula | C8H15Br2N3OSi |
| Molecular Weight | 357.12 g/mol |
| Exact Mass | 354.94 |
| IUPAC Name | 2-[(3,5-dibromo-1,2,4-triazol-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1nc(Br)nc1Br |
| InChI | InChI=1S/C8H15Br2N3OSi/c1-15(2,3)5-4-14-6-13-8(10)11-7(9)12-13/h4-6H2,1-3H3 |
| InChIKey | RMQHUTDZCYCWIW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.12 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|