C31H32F6N4O6 — CID 90149906
1-(4-naphthalen-2-ylpiperazin-1-yl)-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone;2,2,2-trifluoroacetic acid (PubChem CID 90149906) has the molecular formula C31H32F6N4O6 and a molecular weight of 670.61 g/mol. Its IUPAC name is 1-(4-naphthalen-2-ylpiperazin-1-yl)-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 1-(4-naphthalen-2-ylpiperazin-1-yl)-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 90149906 |
| Molecular Formula | C31H32F6N4O6 |
| Molecular Weight | 670.61 g/mol |
| Exact Mass | 670.22 |
| IUPAC Name | 1-(4-naphthalen-2-ylpiperazin-1-yl)-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(COC1CCC(Nc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)CC1)N1CCN(c2ccc3ccccc3c2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C29H31F3N4O4.C2HF3O2/c30-29(31,32)26-18-23(8-12-27(26)36(38)39)33-22-6-10-25(11-7-22)40-19-28(37)35-15-13-34(14-16-35)24-9-5-20-3-1-2-4-21(20)17-24;3-2(4,5)1(6)7/h1-5,8-9,12,17-18,22,25,33H,6-7,10-11,13-16,19H2;(H,6,7) |
| InChIKey | UOIFRXHMBINYNZ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 125.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.61 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|