C32H36F4N4O4 — CID 90149943
1-[(3S,5R)-4-[(6-fluoronaphthalen-2-yl)methyl]-3,5-dimethylpiperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone (PubChem CID 90149943) has the molecular formula C32H36F4N4O4 and a molecular weight of 616.66 g/mol. Its IUPAC name is 1-[(3S,5R)-4-[(6-fluoronaphthalen-2-yl)methyl]-3,5-dimethylpiperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone.
| Compound Name | 1-[(3S,5R)-4-[(6-fluoronaphthalen-2-yl)methyl]-3,5-dimethylpiperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone |
|---|---|
| PubChem CID | 90149943 |
| Molecular Formula | C32H36F4N4O4 |
| Molecular Weight | 616.66 g/mol |
| Exact Mass | 616.27 |
| IUPAC Name | 1-[(3S,5R)-4-[(6-fluoronaphthalen-2-yl)methyl]-3,5-dimethylpiperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone |
| SMILES | C[C@@H]1CN(C(=O)COC2CCC(Nc3ccc([N+](=O)[O-])c(C(F)(F)F)c3)CC2)C[C@H](C)N1Cc1ccc2cc(F)ccc2c1 |
| InChI | InChI=1S/C32H36F4N4O4/c1-20-16-38(17-21(2)39(20)18-22-3-4-24-14-25(33)6-5-23(24)13-22)31(41)19-44-28-10-7-26(8-11-28)37-27-9-12-30(40(42)43)29(15-27)32(34,35)36/h3-6,9,12-15,20-21,26,28,37H,7-8,10-11,16-19H2,1-2H3/t20-,21+,26?,28? |
| InChIKey | YHEOPZSHCUQGHK-IEQDKFOCSA-N |
| XLogP | 6.77 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.66 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|