C29H29F5N4O4 — CID 90150103
1-[4-(1,6-difluoronaphthalen-2-yl)piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone (PubChem CID 90150103) has the molecular formula C29H29F5N4O4 and a molecular weight of 592.57 g/mol. Its IUPAC name is 1-[4-(1,6-difluoronaphthalen-2-yl)piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone.
| Compound Name | 1-[4-(1,6-difluoronaphthalen-2-yl)piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone |
|---|---|
| PubChem CID | 90150103 |
| Molecular Formula | C29H29F5N4O4 |
| Molecular Weight | 592.57 g/mol |
| Exact Mass | 592.21 |
| IUPAC Name | 1-[4-(1,6-difluoronaphthalen-2-yl)piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone |
| SMILES | O=C(COC1CCC(Nc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)CC1)N1CCN(c2ccc3cc(F)ccc3c2F)CC1 |
| InChI | InChI=1S/C29H29F5N4O4/c30-19-2-8-23-18(15-19)1-9-26(28(23)31)36-11-13-37(14-12-36)27(39)17-42-22-6-3-20(4-7-22)35-21-5-10-25(38(40)41)24(16-21)29(32,33)34/h1-2,5,8-10,15-16,20,22,35H,3-4,6-7,11-14,17H2 |
| InChIKey | RAIMURWOYIKBLY-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.57 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|