C30H25F5N4O3 — CID 90150200
3-[2-[2-(3,5-difluorophenyl)-1-[[2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetyl]amino]ethyl]-3-pyridinyl]benzoic acid (PubChem CID 90150200) has the molecular formula C30H25F5N4O3 and a molecular weight of 584.55 g/mol. Its IUPAC name is 3-[2-[2-(3,5-difluorophenyl)-1-[[2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetyl]amino]ethyl]-3-pyridinyl]benzoic acid.
| Compound Name | 3-[2-[2-(3,5-difluorophenyl)-1-[[2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetyl]amino]ethyl]-3-pyridinyl]benzoic acid |
|---|---|
| PubChem CID | 90150200 |
| Molecular Formula | C30H25F5N4O3 |
| Molecular Weight | 584.55 g/mol |
| Exact Mass | 584.18 |
| IUPAC Name | 3-[2-[2-(3,5-difluorophenyl)-1-[[2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetyl]amino]ethyl]-3-pyridinyl]benzoic acid |
| SMILES | O=C(Cn1nc(C(F)(F)F)c2c1CCCC2)NC(Cc1cc(F)cc(F)c1)c1ncccc1-c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C30H25F5N4O3/c31-20-11-17(12-21(32)15-20)13-24(27-22(8-4-10-36-27)18-5-3-6-19(14-18)29(41)42)37-26(40)16-39-25-9-2-1-7-23(25)28(38-39)30(33,34)35/h3-6,8,10-12,14-15,24H,1-2,7,9,13,16H2,(H,37,40)(H,41,42) |
| InChIKey | WOSHTWSFVFSNKC-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.55 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |