C27H26N6O4S — CID 90150672
4-[(Z)-[2-[N-acetyl-4-(4-methylpiperazin-1-yl)anilino]-6-oxo-5H-pyrimido[4,5-b][1,4]thiazin-7-ylidene]methyl]benzoic acid (PubChem CID 90150672) has the molecular formula C27H26N6O4S and a molecular weight of 530.61 g/mol. Its IUPAC name is 4-[(Z)-[2-[N-acetyl-4-(4-methylpiperazin-1-yl)anilino]-6-oxo-5H-pyrimido[4,5-b][1,4]thiazin-7-ylidene]methyl]benzoic acid.
| Compound Name | 4-[(Z)-[2-[N-acetyl-4-(4-methylpiperazin-1-yl)anilino]-6-oxo-5H-pyrimido[4,5-b][1,4]thiazin-7-ylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 90150672 |
| Molecular Formula | C27H26N6O4S |
| Molecular Weight | 530.61 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | 4-[(Z)-[2-[N-acetyl-4-(4-methylpiperazin-1-yl)anilino]-6-oxo-5H-pyrimido[4,5-b][1,4]thiazin-7-ylidene]methyl]benzoic acid |
| SMILES | CC(=O)N(c1ccc(N2CCN(C)CC2)cc1)c1ncc2c(n1)S/C(=C\c1ccc(C(=O)O)cc1)C(=O)N2 |
| InChI | InChI=1S/C27H26N6O4S/c1-17(34)33(21-9-7-20(8-10-21)32-13-11-31(2)12-14-32)27-28-16-22-25(30-27)38-23(24(35)29-22)15-18-3-5-19(6-4-18)26(36)37/h3-10,15-16H,11-14H2,1-2H3,(H,29,35)(H,36,37)/b23-15- |
| InChIKey | VSWYXGWCLFOONQ-HAHDFKILSA-N |
| XLogP | 3.70 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.61 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|