About N'-cyclopropyl-N,4-dimethylpent-2-enehydrazide
N'-cyclopropyl-N,4-dimethylpent-2-enehydrazide (PubChem CID 90151313) has the molecular formula C10H18N2O
and a molecular weight of 182.27 g/mol. Its IUPAC name is N'-cyclopropyl-N,4-dimethylpent-2-enehydrazide.
Molecular Properties
| Compound Name | N'-cyclopropyl-N,4-dimethylpent-2-enehydrazide |
| PubChem CID | 90151313 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | N'-cyclopropyl-N,4-dimethylpent-2-enehydrazide |
| SMILES | CC(C)C=CC(=O)N(C)NC1CC1 |
| InChI | InChI=1S/C10H18N2O/c1-8(2)4-7-10(13)12(3)11-9-5-6-9/h4,7-9,11H,5-6H2,1-3H3 |
| InChIKey | WKZKJJXHLDWDJC-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-cyclopropyl-N,4-dimethylpent-2-enehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cyclopropyl-N,4-dimethylpent-2-enehydrazide?
The IUPAC name of N'-cyclopropyl-N,4-dimethylpent-2-enehydrazide (CID 90151313) is N'-cyclopropyl-N,4-dimethylpent-2-enehydrazide.
What is the SMILES notation for N'-cyclopropyl-N,4-dimethylpent-2-enehydrazide?
The canonical SMILES for N'-cyclopropyl-N,4-dimethylpent-2-enehydrazide is CC(C)C=CC(=O)N(C)NC1CC1.
What is the InChIKey of N'-cyclopropyl-N,4-dimethylpent-2-enehydrazide?
The InChIKey is WKZKJJXHLDWDJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O/c1-8(2)4-7-10(13)12(3)11-9-5-6-9/h4,7-9,11H,5-6H2,1-3H3.
What are the key properties of N'-cyclopropyl-N,4-dimethylpent-2-enehydrazide?
N'-cyclopropyl-N,4-dimethylpent-2-enehydrazide has a molecular weight of 182.27 g/mol, XLogP of 1.32, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cyclopropyl-N,4-dimethylpent-2-enehydrazide is sourced from PubChem (CID 90151313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).