C19H31F2NO2Si — CID 90151407
tert-butyl-[(3R,4S)-1-(2,3-difluoro-5-methoxyphenyl)-3-methylpiperidin-4-yl]oxy-dimethylsilane (PubChem CID 90151407) has the molecular formula C19H31F2NO2Si and a molecular weight of 371.54 g/mol. Its IUPAC name is tert-butyl-[(3R,4S)-1-(2,3-difluoro-5-methoxyphenyl)-3-methylpiperidin-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3R,4S)-1-(2,3-difluoro-5-methoxyphenyl)-3-methylpiperidin-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 90151407 |
| Molecular Formula | C19H31F2NO2Si |
| Molecular Weight | 371.54 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | tert-butyl-[(3R,4S)-1-(2,3-difluoro-5-methoxyphenyl)-3-methylpiperidin-4-yl]oxy-dimethylsilane |
| SMILES | COc1cc(F)c(F)c(N2CC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C2)c1 |
| InChI | InChI=1S/C19H31F2NO2Si/c1-13-12-22(16-11-14(23-5)10-15(20)18(16)21)9-8-17(13)24-25(6,7)19(2,3)4/h10-11,13,17H,8-9,12H2,1-7H3/t13-,17+/m1/s1 |
| InChIKey | DLSHQVXAQMBWKG-DYVFJYSZSA-N |
| XLogP | 5.21 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.54 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|