C9H6N6O12 — CID 90151574
[4,6-bis(dicarboxyamino)-1,3,5-triazin-2-yl]-carboxycarbamic acid (PubChem CID 90151574) has the molecular formula C9H6N6O12 and a molecular weight of 390.18 g/mol. Its IUPAC name is [4,6-bis(dicarboxyamino)-1,3,5-triazin-2-yl]-carboxycarbamic acid.
| Compound Name | [4,6-bis(dicarboxyamino)-1,3,5-triazin-2-yl]-carboxycarbamic acid |
|---|---|
| PubChem CID | 90151574 |
| Molecular Formula | C9H6N6O12 |
| Molecular Weight | 390.18 g/mol |
| Exact Mass | 390.00 |
| IUPAC Name | [4,6-bis(dicarboxyamino)-1,3,5-triazin-2-yl]-carboxycarbamic acid |
| SMILES | O=C(O)N(C(=O)O)c1nc(N(C(=O)O)C(=O)O)nc(N(C(=O)O)C(=O)O)n1 |
| InChI | InChI=1S/C9H6N6O12/c16-4(17)13(5(18)19)1-10-2(14(6(20)21)7(22)23)12-3(11-1)15(8(24)25)9(26)27/h(H,16,17)(H,18,19)(H,20,21)(H,22,23)(H,24,25)(H,26,27) |
| InChIKey | LNHCTGDNVISLFP-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 272.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.18 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |