About (E)-2-cyano-N,4-dimethylpent-2-enamide
(E)-2-cyano-N,4-dimethylpent-2-enamide (PubChem CID 90151615) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is (E)-2-cyano-N,4-dimethylpent-2-enamide.
Molecular Properties
| Compound Name | (E)-2-cyano-N,4-dimethylpent-2-enamide |
| PubChem CID | 90151615 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | (E)-2-cyano-N,4-dimethylpent-2-enamide |
| SMILES | CNC(=O)/C(C#N)=C/C(C)C |
| InChI | InChI=1S/C8H12N2O/c1-6(2)4-7(5-9)8(11)10-3/h4,6H,1-3H3,(H,10,11)/b7-4+ |
| InChIKey | ALUQPGQGXJRMQZ-QPJJXVBHSA-N |
| XLogP | 0.84 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-cyano-N,4-dimethylpent-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-cyano-N,4-dimethylpent-2-enamide?
The IUPAC name of (E)-2-cyano-N,4-dimethylpent-2-enamide (CID 90151615) is (E)-2-cyano-N,4-dimethylpent-2-enamide.
What is the SMILES notation for (E)-2-cyano-N,4-dimethylpent-2-enamide?
The canonical SMILES for (E)-2-cyano-N,4-dimethylpent-2-enamide is CNC(=O)/C(C#N)=C/C(C)C.
What is the InChIKey of (E)-2-cyano-N,4-dimethylpent-2-enamide?
The InChIKey is ALUQPGQGXJRMQZ-QPJJXVBHSA-N. The full InChI is InChI=1S/C8H12N2O/c1-6(2)4-7(5-9)8(11)10-3/h4,6H,1-3H3,(H,10,11)/b7-4+.
What are the key properties of (E)-2-cyano-N,4-dimethylpent-2-enamide?
(E)-2-cyano-N,4-dimethylpent-2-enamide has a molecular weight of 152.20 g/mol, XLogP of 0.84, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-cyano-N,4-dimethylpent-2-enamide is sourced from PubChem (CID 90151615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).