About (E)-2,3-dimethyl-4-(methylamino)pent-2-enamide
(E)-2,3-dimethyl-4-(methylamino)pent-2-enamide (PubChem CID 90151676) has the molecular formula C8H16N2O
and a molecular weight of 156.23 g/mol. Its IUPAC name is (E)-2,3-dimethyl-4-(methylamino)pent-2-enamide.
Molecular Properties
| Compound Name | (E)-2,3-dimethyl-4-(methylamino)pent-2-enamide |
| PubChem CID | 90151676 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | (E)-2,3-dimethyl-4-(methylamino)pent-2-enamide |
| SMILES | CNC(C)/C(C)=C(\C)C(N)=O |
| InChI | InChI=1S/C8H16N2O/c1-5(7(3)10-4)6(2)8(9)11/h7,10H,1-4H3,(H2,9,11)/b6-5+ |
| InChIKey | YNCHVTUQHBIGDM-AATRIKPKSA-N |
| XLogP | 0.42 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2,3-dimethyl-4-(methylamino)pent-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,3-dimethyl-4-(methylamino)pent-2-enamide?
The IUPAC name of (E)-2,3-dimethyl-4-(methylamino)pent-2-enamide (CID 90151676) is (E)-2,3-dimethyl-4-(methylamino)pent-2-enamide.
What is the SMILES notation for (E)-2,3-dimethyl-4-(methylamino)pent-2-enamide?
The canonical SMILES for (E)-2,3-dimethyl-4-(methylamino)pent-2-enamide is CNC(C)/C(C)=C(\C)C(N)=O.
What is the InChIKey of (E)-2,3-dimethyl-4-(methylamino)pent-2-enamide?
The InChIKey is YNCHVTUQHBIGDM-AATRIKPKSA-N. The full InChI is InChI=1S/C8H16N2O/c1-5(7(3)10-4)6(2)8(9)11/h7,10H,1-4H3,(H2,9,11)/b6-5+.
What are the key properties of (E)-2,3-dimethyl-4-(methylamino)pent-2-enamide?
(E)-2,3-dimethyl-4-(methylamino)pent-2-enamide has a molecular weight of 156.23 g/mol, XLogP of 0.42, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,3-dimethyl-4-(methylamino)pent-2-enamide is sourced from PubChem (CID 90151676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).