C15H6F14O3 — CID 90152139
1-ethynyl-3-[1,1,2-trifluoro-2-[1,2,2,2-tetrafluoro-1-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]ethoxy]benzene (PubChem CID 90152139) has the molecular formula C15H6F14O3 and a molecular weight of 500.18 g/mol. Its IUPAC name is 1-ethynyl-3-[1,1,2-trifluoro-2-[1,2,2,2-tetrafluoro-1-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]ethoxy]benzene.
| Compound Name | 1-ethynyl-3-[1,1,2-trifluoro-2-[1,2,2,2-tetrafluoro-1-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]ethoxy]benzene |
|---|---|
| PubChem CID | 90152139 |
| Molecular Formula | C15H6F14O3 |
| Molecular Weight | 500.18 g/mol |
| Exact Mass | 500.01 |
| IUPAC Name | 1-ethynyl-3-[1,1,2-trifluoro-2-[1,2,2,2-tetrafluoro-1-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]ethoxy]benzene |
| SMILES | C#Cc1cccc(OC(F)(F)C(F)OC(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C15H6F14O3/c1-2-7-4-3-5-8(6-7)30-10(17,18)9(16)31-15(29,13(24,25)26)32-14(27,28)11(19,20)12(21,22)23/h1,3-6,9H |
| InChIKey | QEGRTUWKPXHIKZ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.18 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|