C16H19OP — CID 90152256
1,3,5-trimethyl-2-[methyl(phenyl)phosphoryl]benzene (PubChem CID 90152256) has the molecular formula C16H19OP and a molecular weight of 258.30 g/mol. Its IUPAC name is 1,3,5-trimethyl-2-[methyl(phenyl)phosphoryl]benzene.
| Compound Name | 1,3,5-trimethyl-2-[methyl(phenyl)phosphoryl]benzene |
|---|---|
| PubChem CID | 90152256 |
| Molecular Formula | C16H19OP |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 1,3,5-trimethyl-2-[methyl(phenyl)phosphoryl]benzene |
| SMILES | Cc1cc(C)c([P@@](C)(=O)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C16H19OP/c1-12-10-13(2)16(14(3)11-12)18(4,17)15-8-6-5-7-9-15/h5-11H,1-4H3/t18-/m0/s1 |
| InChIKey | WUPDWPFZMLFVHC-SFHVURJKSA-N |
| XLogP | 3.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|