C14H20N2 — CID 90152403
(2Z,4E)-5-(1,2-dimethyl-2-pyridinyl)-N-methylhexa-2,4-dien-1-imine (PubChem CID 90152403) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is (2Z,4E)-5-(1,2-dimethyl-2-pyridinyl)-N-methylhexa-2,4-dien-1-imine.
| Compound Name | (2Z,4E)-5-(1,2-dimethyl-2-pyridinyl)-N-methylhexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 90152403 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | (2Z,4E)-5-(1,2-dimethyl-2-pyridinyl)-N-methylhexa-2,4-dien-1-imine |
| SMILES | C/N=C/C=C\C=C(/C)C1(C)C=CC=CN1C |
| InChI | InChI=1S/C14H20N2/c1-13(9-5-7-11-15-3)14(2)10-6-8-12-16(14)4/h5-12H,1-4H3/b7-5-,13-9+,15-11+ |
| InChIKey | JMNACYISLBDYSZ-IPOVVDCWSA-N |
| XLogP | 2.96 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|