About CID 90152449
CID 90152449 (PubChem CID 90152449) has the molecular formula C16H27BN4O2S
and a molecular weight of 350.30 g/mol.
Molecular Properties
| Compound Name | CID 90152449 |
| PubChem CID | 90152449 |
| Molecular Formula | C16H27BN4O2S |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1CCCN1C(=S)[C@H](C)NC(=O)[C@@H]1CCCCN1C(=O)CNC |
| InChI | InChI=1S/C16H27BN4O2S/c1-11(16(24)21-9-5-7-13(21)17)19-15(23)12-6-3-4-8-20(12)14(22)10-18-2/h11-13,18H,3-10H2,1-2H3,(H,19,23)/t11-,12-,13-/m0/s1 |
| InChIKey | QPXHXQAPUJWWPL-AVGNSLFASA-N |
| XLogP | 0.01 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze CID 90152449 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90152449?
The IUPAC name of CID 90152449 (CID 90152449) is not available.
What is the SMILES notation for CID 90152449?
The canonical SMILES for CID 90152449 is [B][C@@H]1CCCN1C(=S)[C@H](C)NC(=O)[C@@H]1CCCCN1C(=O)CNC.
What is the InChIKey of CID 90152449?
The InChIKey is QPXHXQAPUJWWPL-AVGNSLFASA-N. The full InChI is InChI=1S/C16H27BN4O2S/c1-11(16(24)21-9-5-7-13(21)17)19-15(23)12-6-3-4-8-20(12)14(22)10-18-2/h11-13,18H,3-10H2,1-2H3,(H,19,23)/t11-,12-,13-/m0/s1.
What are the key properties of CID 90152449?
CID 90152449 has a molecular weight of 350.30 g/mol, XLogP of 0.01, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90152449 is sourced from PubChem (CID 90152449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).