C16H27BN4O2S — CID 90152449
CID 90152449 (PubChem CID 90152449) has the molecular formula C16H27BN4O2S and a molecular weight of 350.30 g/mol.
| Compound Name | CID 90152449 |
|---|---|
| PubChem CID | 90152449 |
| Molecular Formula | C16H27BN4O2S |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1CCCN1C(=S)[C@H](C)NC(=O)[C@@H]1CCCCN1C(=O)CNC |
| InChI | InChI=1S/C16H27BN4O2S/c1-11(16(24)21-9-5-7-13(21)17)19-15(23)12-6-3-4-8-20(12)14(22)10-18-2/h11-13,18H,3-10H2,1-2H3,(H,19,23)/t11-,12-,13-/m0/s1 |
| InChIKey | QPXHXQAPUJWWPL-AVGNSLFASA-N |
| XLogP | 0.01 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|