C24H20FN3O2 — CID 90152727
5-cyclopropyl-2-[[7-(3-fluorophenyl)-1-methylindol-5-yl]amino]pyridine-3-carboxylic acid (PubChem CID 90152727) has the molecular formula C24H20FN3O2 and a molecular weight of 401.44 g/mol. Its IUPAC name is 5-cyclopropyl-2-[[7-(3-fluorophenyl)-1-methylindol-5-yl]amino]pyridine-3-carboxylic acid.
| Compound Name | 5-cyclopropyl-2-[[7-(3-fluorophenyl)-1-methylindol-5-yl]amino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 90152727 |
| Molecular Formula | C24H20FN3O2 |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 5-cyclopropyl-2-[[7-(3-fluorophenyl)-1-methylindol-5-yl]amino]pyridine-3-carboxylic acid |
| SMILES | Cn1ccc2cc(Nc3ncc(C4CC4)cc3C(=O)O)cc(-c3cccc(F)c3)c21 |
| InChI | InChI=1S/C24H20FN3O2/c1-28-8-7-16-10-19(12-20(22(16)28)15-3-2-4-18(25)9-15)27-23-21(24(29)30)11-17(13-26-23)14-5-6-14/h2-4,7-14H,5-6H2,1H3,(H,26,27)(H,29,30) |
| InChIKey | BLTXTLKNUZVRKN-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |