About methyl 2-[(1-benzyl-4,6-difluoroindol-5-yl)amino]-5-cyclopropylpyridine-3-carboxylate
methyl 2-[(1-benzyl-4,6-difluoroindol-5-yl)amino]-5-cyclopropylpyridine-3-carboxylate (PubChem CID 90152867) has the molecular formula C25H21F2N3O2
and a molecular weight of 433.46 g/mol. Its IUPAC name is methyl 2-[(1-benzyl-4,6-difluoroindol-5-yl)amino]-5-cyclopropylpyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 2-[(1-benzyl-4,6-difluoroindol-5-yl)amino]-5-cyclopropylpyridine-3-carboxylate |
| PubChem CID | 90152867 |
| Molecular Formula | C25H21F2N3O2 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | methyl 2-[(1-benzyl-4,6-difluoroindol-5-yl)amino]-5-cyclopropylpyridine-3-carboxylate |
| SMILES | COC(=O)c1cc(C2CC2)cnc1Nc1c(F)cc2c(ccn2Cc2ccccc2)c1F |
| InChI | InChI=1S/C25H21F2N3O2/c1-32-25(31)19-11-17(16-7-8-16)13-28-24(19)29-23-20(26)12-21-18(22(23)27)9-10-30(21)14-15-5-3-2-4-6-15/h2-6,9-13,16H,7-8,14H2,1H3,(H,28,29) |
| InChIKey | NTQACOVBMWIYQQ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[(1-benzyl-4,6-difluoroindol-5-yl)amino]-5-cyclopropylpyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(1-benzyl-4,6-difluoroindol-5-yl)amino]-5-cyclopropylpyridine-3-carboxylate?
The IUPAC name of methyl 2-[(1-benzyl-4,6-difluoroindol-5-yl)amino]-5-cyclopropylpyridine-3-carboxylate (CID 90152867) is methyl 2-[(1-benzyl-4,6-difluoroindol-5-yl)amino]-5-cyclopropylpyridine-3-carboxylate.
What is the SMILES notation for methyl 2-[(1-benzyl-4,6-difluoroindol-5-yl)amino]-5-cyclopropylpyridine-3-carboxylate?
The canonical SMILES for methyl 2-[(1-benzyl-4,6-difluoroindol-5-yl)amino]-5-cyclopropylpyridine-3-carboxylate is COC(=O)c1cc(C2CC2)cnc1Nc1c(F)cc2c(ccn2Cc2ccccc2)c1F.
What is the InChIKey of methyl 2-[(1-benzyl-4,6-difluoroindol-5-yl)amino]-5-cyclopropylpyridine-3-carboxylate?
The InChIKey is NTQACOVBMWIYQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21F2N3O2/c1-32-25(31)19-11-17(16-7-8-16)13-28-24(19)29-23-20(26)12-21-18(22(23)27)9-10-30(21)14-15-5-3-2-4-6-15/h2-6,9-13,16H,7-8,14H2,1H3,(H,28,29).
What are the key properties of methyl 2-[(1-benzyl-4,6-difluoroindol-5-yl)amino]-5-cyclopropylpyridine-3-carboxylate?
methyl 2-[(1-benzyl-4,6-difluoroindol-5-yl)amino]-5-cyclopropylpyridine-3-carboxylate has a molecular weight of 433.46 g/mol, XLogP of 5.77, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(1-benzyl-4,6-difluoroindol-5-yl)amino]-5-cyclopropylpyridine-3-carboxylate is sourced from PubChem (CID 90152867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).