C17H20N2O6 — CID 9015321
1-O-ethyl 4-O-[2-[3-(ethylcarbamoyl)anilino]-2-oxoethyl] (E)-but-2-enedioate (PubChem CID 9015321) has the molecular formula C17H20N2O6 and a molecular weight of 348.36 g/mol. Its IUPAC name is 1-O-ethyl 4-O-[2-[3-(ethylcarbamoyl)anilino]-2-oxoethyl] (E)-but-2-enedioate.
| Compound Name | 1-O-ethyl 4-O-[2-[3-(ethylcarbamoyl)anilino]-2-oxoethyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 9015321 |
| Molecular Formula | C17H20N2O6 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 1-O-ethyl 4-O-[2-[3-(ethylcarbamoyl)anilino]-2-oxoethyl] (E)-but-2-enedioate |
| SMILES | CCNC(=O)c1cccc(NC(=O)COC(=O)/C=C/C(=O)OCC)c1 |
| InChI | InChI=1S/C17H20N2O6/c1-3-18-17(23)12-6-5-7-13(10-12)19-14(20)11-25-16(22)9-8-15(21)24-4-2/h5-10H,3-4,11H2,1-2H3,(H,18,23)(H,19,20)/b9-8+ |
| InChIKey | MFRGCPKELAAUPH-CMDGGOBGSA-N |
| XLogP | 1.04 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|