C22H25N5O — CID 90153325
(1S,9R,13R)-4-methoxy-1,10-dimethyl-13-[3-(2H-tetrazol-5-yl)phenyl]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene (PubChem CID 90153325) has the molecular formula C22H25N5O and a molecular weight of 375.48 g/mol. Its IUPAC name is (1S,9R,13R)-4-methoxy-1,10-dimethyl-13-[3-(2H-tetrazol-5-yl)phenyl]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene.
| Compound Name | (1S,9R,13R)-4-methoxy-1,10-dimethyl-13-[3-(2H-tetrazol-5-yl)phenyl]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene |
|---|---|
| PubChem CID | 90153325 |
| Molecular Formula | C22H25N5O |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | (1S,9R,13R)-4-methoxy-1,10-dimethyl-13-[3-(2H-tetrazol-5-yl)phenyl]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene |
| SMILES | COc1ccc2c(c1)[C@@]1(C)CCN(C)[C@H](C2)[C@@H]1c1cccc(-c2nn[nH]n2)c1 |
| InChI | InChI=1S/C22H25N5O/c1-22-9-10-27(2)19(12-14-7-8-17(28-3)13-18(14)22)20(22)15-5-4-6-16(11-15)21-23-25-26-24-21/h4-8,11,13,19-20H,9-10,12H2,1-3H3,(H,23,24,25,26)/t19-,20+,22-/m1/s1 |
| InChIKey | CCNUEQBJOWDHRS-RZUBCFFCSA-N |
| XLogP | 3.18 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |