About (7S)-7-methyl-7,8-dihydro-6H-pyrido[3,2-b]azepine
(7S)-7-methyl-7,8-dihydro-6H-pyrido[3,2-b]azepine (PubChem CID 90153623) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is (7S)-7-methyl-7,8-dihydro-6H-pyrido[3,2-b]azepine.
Molecular Properties
| Compound Name | (7S)-7-methyl-7,8-dihydro-6H-pyrido[3,2-b]azepine |
| PubChem CID | 90153623 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | (7S)-7-methyl-7,8-dihydro-6H-pyrido[3,2-b]azepine |
| SMILES | C[C@H]1CC=c2ncccc2=NC1 |
| InChI | InChI=1S/C10H12N2/c1-8-4-5-10-9(12-7-8)3-2-6-11-10/h2-3,5-6,8H,4,7H2,1H3/t8-/m0/s1 |
| InChIKey | SRENUNTUABRIBH-QMMMGPOBSA-N |
| XLogP | 0.52 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (7S)-7-methyl-7,8-dihydro-6H-pyrido[3,2-b]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7S)-7-methyl-7,8-dihydro-6H-pyrido[3,2-b]azepine?
The IUPAC name of (7S)-7-methyl-7,8-dihydro-6H-pyrido[3,2-b]azepine (CID 90153623) is (7S)-7-methyl-7,8-dihydro-6H-pyrido[3,2-b]azepine.
What is the SMILES notation for (7S)-7-methyl-7,8-dihydro-6H-pyrido[3,2-b]azepine?
The canonical SMILES for (7S)-7-methyl-7,8-dihydro-6H-pyrido[3,2-b]azepine is C[C@H]1CC=c2ncccc2=NC1.
What is the InChIKey of (7S)-7-methyl-7,8-dihydro-6H-pyrido[3,2-b]azepine?
The InChIKey is SRENUNTUABRIBH-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H12N2/c1-8-4-5-10-9(12-7-8)3-2-6-11-10/h2-3,5-6,8H,4,7H2,1H3/t8-/m0/s1.
What are the key properties of (7S)-7-methyl-7,8-dihydro-6H-pyrido[3,2-b]azepine?
(7S)-7-methyl-7,8-dihydro-6H-pyrido[3,2-b]azepine has a molecular weight of 160.22 g/mol, XLogP of 0.52, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7S)-7-methyl-7,8-dihydro-6H-pyrido[3,2-b]azepine is sourced from PubChem (CID 90153623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).