About 3-[[3-(4-tert-butylphenyl)phenyl]methoxy]-2,6-difluorobenzamide
3-[[3-(4-tert-butylphenyl)phenyl]methoxy]-2,6-difluorobenzamide (PubChem CID 90153643) has the molecular formula C24H23F2NO2
and a molecular weight of 395.45 g/mol. Its IUPAC name is 3-[[3-(4-tert-butylphenyl)phenyl]methoxy]-2,6-difluorobenzamide.
Molecular Properties
| Compound Name | 3-[[3-(4-tert-butylphenyl)phenyl]methoxy]-2,6-difluorobenzamide |
| PubChem CID | 90153643 |
| Molecular Formula | C24H23F2NO2 |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 3-[[3-(4-tert-butylphenyl)phenyl]methoxy]-2,6-difluorobenzamide |
| SMILES | CC(C)(C)c1ccc(-c2cccc(COc3ccc(F)c(C(N)=O)c3F)c2)cc1 |
| InChI | InChI=1S/C24H23F2NO2/c1-24(2,3)18-9-7-16(8-10-18)17-6-4-5-15(13-17)14-29-20-12-11-19(25)21(22(20)26)23(27)28/h4-13H,14H2,1-3H3,(H2,27,28) |
| InChIKey | XBCMCUVILUTGMC-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[[3-(4-tert-butylphenyl)phenyl]methoxy]-2,6-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[3-(4-tert-butylphenyl)phenyl]methoxy]-2,6-difluorobenzamide?
The IUPAC name of 3-[[3-(4-tert-butylphenyl)phenyl]methoxy]-2,6-difluorobenzamide (CID 90153643) is 3-[[3-(4-tert-butylphenyl)phenyl]methoxy]-2,6-difluorobenzamide.
What is the SMILES notation for 3-[[3-(4-tert-butylphenyl)phenyl]methoxy]-2,6-difluorobenzamide?
The canonical SMILES for 3-[[3-(4-tert-butylphenyl)phenyl]methoxy]-2,6-difluorobenzamide is CC(C)(C)c1ccc(-c2cccc(COc3ccc(F)c(C(N)=O)c3F)c2)cc1.
What is the InChIKey of 3-[[3-(4-tert-butylphenyl)phenyl]methoxy]-2,6-difluorobenzamide?
The InChIKey is XBCMCUVILUTGMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23F2NO2/c1-24(2,3)18-9-7-16(8-10-18)17-6-4-5-15(13-17)14-29-20-12-11-19(25)21(22(20)26)23(27)28/h4-13H,14H2,1-3H3,(H2,27,28).
What are the key properties of 3-[[3-(4-tert-butylphenyl)phenyl]methoxy]-2,6-difluorobenzamide?
3-[[3-(4-tert-butylphenyl)phenyl]methoxy]-2,6-difluorobenzamide has a molecular weight of 395.45 g/mol, XLogP of 5.61, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[3-(4-tert-butylphenyl)phenyl]methoxy]-2,6-difluorobenzamide is sourced from PubChem (CID 90153643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).