About N-([1,1'-Biphenyl]-3-yl)-[1,1':3',1''-terphenyl]-4'-amine
N-([1,1'-Biphenyl]-3-yl)-[1,1':3',1''-terphenyl]-4'-amine (PubChem CID 90153748) has the molecular formula C30H23N
and a molecular weight of 397.50 g/mol. Its IUPAC name is 2,4-diphenyl-N-(3-phenylphenyl)aniline.
Molecular Properties
| Compound Name | N-([1,1'-Biphenyl]-3-yl)-[1,1':3',1''-terphenyl]-4'-amine |
| PubChem CID | 90153748 |
| Molecular Formula | C30H23N |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 2,4-diphenyl-N-(3-phenylphenyl)aniline |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)NC3=C(C=C(C=C3)C4=CC=CC=C4)C5=CC=CC=C5 |
| InChI | InChI=1S/C30H23N/c1-4-11-23(12-5-1)26-17-10-18-28(21-26)31-30-20-19-27(24-13-6-2-7-14-24)22-29(30)25-15-8-3-9-16-25/h1-22,31H |
| InChIKey | CCZLEXCRLFXSCX-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 12.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | 511 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-([1,1'-Biphenyl]-3-yl)-[1,1':3',1''-terphenyl]-4'-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-([1,1'-Biphenyl]-3-yl)-[1,1':3',1''-terphenyl]-4'-amine?
The IUPAC name of N-([1,1'-Biphenyl]-3-yl)-[1,1':3',1''-terphenyl]-4'-amine (CID 90153748) is 2,4-diphenyl-N-(3-phenylphenyl)aniline.
What is the SMILES notation for N-([1,1'-Biphenyl]-3-yl)-[1,1':3',1''-terphenyl]-4'-amine?
The canonical SMILES for N-([1,1'-Biphenyl]-3-yl)-[1,1':3',1''-terphenyl]-4'-amine is C1=CC=C(C=C1)C2=CC(=CC=C2)NC3=C(C=C(C=C3)C4=CC=CC=C4)C5=CC=CC=C5.
What is the InChIKey of N-([1,1'-Biphenyl]-3-yl)-[1,1':3',1''-terphenyl]-4'-amine?
The InChIKey is CCZLEXCRLFXSCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H23N/c1-4-11-23(12-5-1)26-17-10-18-28(21-26)31-30-20-19-27(24-13-6-2-7-14-24)22-29(30)25-15-8-3-9-16-25/h1-22,31H.
What are the key properties of N-([1,1'-Biphenyl]-3-yl)-[1,1':3',1''-terphenyl]-4'-amine?
N-([1,1'-Biphenyl]-3-yl)-[1,1':3',1''-terphenyl]-4'-amine has a molecular weight of 397.50 g/mol, XLogP of 8.30, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-([1,1'-Biphenyl]-3-yl)-[1,1':3',1''-terphenyl]-4'-amine is sourced from PubChem (CID 90153748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).