C16H8F7N3O2S — CID 90154016
2,6-difluoro-3-[[6-(1,1,2,2,2-pentafluoroethyl)-[1,3]thiazolo[5,4-b]pyridin-2-yl]methoxy]benzamide (PubChem CID 90154016) has the molecular formula C16H8F7N3O2S and a molecular weight of 439.31 g/mol. Its IUPAC name is 2,6-difluoro-3-[[6-(1,1,2,2,2-pentafluoroethyl)-[1,3]thiazolo[5,4-b]pyridin-2-yl]methoxy]benzamide.
| Compound Name | 2,6-difluoro-3-[[6-(1,1,2,2,2-pentafluoroethyl)-[1,3]thiazolo[5,4-b]pyridin-2-yl]methoxy]benzamide |
|---|---|
| PubChem CID | 90154016 |
| Molecular Formula | C16H8F7N3O2S |
| Molecular Weight | 439.31 g/mol |
| Exact Mass | 439.02 |
| IUPAC Name | 2,6-difluoro-3-[[6-(1,1,2,2,2-pentafluoroethyl)-[1,3]thiazolo[5,4-b]pyridin-2-yl]methoxy]benzamide |
| SMILES | NC(=O)c1c(F)ccc(OCc2nc3cc(C(F)(F)C(F)(F)F)cnc3s2)c1F |
| InChI | InChI=1S/C16H8F7N3O2S/c17-7-1-2-9(12(18)11(7)13(24)27)28-5-10-26-8-3-6(4-25-14(8)29-10)15(19,20)16(21,22)23/h1-4H,5H2,(H2,24,27) |
| InChIKey | UYIRZIIAPDOEHE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.31 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|