C14H13NO2 — CID 90154793
1,2,3-Trimethylpyrrolo[1,2-a][3,1]benzoxazin-5-one (PubChem CID 90154793) has the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. Its IUPAC name is 1,2,3-trimethylpyrrolo[1,2-a][3,1]benzoxazin-5-one.
| Compound Name | 1,2,3-Trimethylpyrrolo[1,2-a][3,1]benzoxazin-5-one |
|---|---|
| PubChem CID | 90154793 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 1,2,3-trimethylpyrrolo[1,2-a][3,1]benzoxazin-5-one |
| SMILES | CC1=C(N2C3=CC=CC=C3C(=O)OC2=C1C)C |
| InChI | InChI=1S/C14H13NO2/c1-8-9(2)13-15(10(8)3)12-7-5-4-6-11(12)14(16)17-13/h4-7H,1-3H3 |
| InChIKey | XFYKKMUOIOLUPS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | 330 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |