C25H19N3O5 — CID 90154900
N-[(E)-(5,7-dimethyl-4-oxochromen-3-yl)methylideneamino]-1-methyl-5-oxopyrrolo[1,2-a][3,1]benzoxazine-8-carboxamide (PubChem CID 90154900) has the molecular formula C25H19N3O5 and a molecular weight of 441.44 g/mol. Its IUPAC name is N-[(E)-(5,7-dimethyl-4-oxochromen-3-yl)methylideneamino]-1-methyl-5-oxopyrrolo[1,2-a][3,1]benzoxazine-8-carboxamide.
| Compound Name | N-[(E)-(5,7-dimethyl-4-oxochromen-3-yl)methylideneamino]-1-methyl-5-oxopyrrolo[1,2-a][3,1]benzoxazine-8-carboxamide |
|---|---|
| PubChem CID | 90154900 |
| Molecular Formula | C25H19N3O5 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | N-[(E)-(5,7-dimethyl-4-oxochromen-3-yl)methylideneamino]-1-methyl-5-oxopyrrolo[1,2-a][3,1]benzoxazine-8-carboxamide |
| SMILES | Cc1cc(C)c2c(=O)c(/C=N/NC(=O)c3ccc4c(=O)oc5ccc(C)n5c4c3)coc2c1 |
| InChI | InChI=1S/C25H19N3O5/c1-13-8-14(2)22-20(9-13)32-12-17(23(22)29)11-26-27-24(30)16-5-6-18-19(10-16)28-15(3)4-7-21(28)33-25(18)31/h4-12H,1-3H3,(H,27,30)/b26-11+ |
| InChIKey | XVNLUHZYBUUBAH-KBKYJPHKSA-N |
| XLogP | 3.84 |
| TPSA | 106.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|