C27H31F4N5O3S — CID 90155395
6-(1,3-benzothiazol-6-ylamino)-N-[(2R)-3-cyclopropyl-2,4,4,4-tetrafluoro-3-hydroxybutyl]-4-[[3-(2-hydroxypropan-2-yl)cyclobutyl]amino]pyridine-3-carboxamide (PubChem CID 90155395) has the molecular formula C27H31F4N5O3S and a molecular weight of 581.64 g/mol. Its IUPAC name is 6-(1,3-benzothiazol-6-ylamino)-N-[(2R)-3-cyclopropyl-2,4,4,4-tetrafluoro-3-hydroxybutyl]-4-[[3-(2-hydroxypropan-2-yl)cyclobutyl]amino]pyridine-3-carboxamide.
| Compound Name | 6-(1,3-benzothiazol-6-ylamino)-N-[(2R)-3-cyclopropyl-2,4,4,4-tetrafluoro-3-hydroxybutyl]-4-[[3-(2-hydroxypropan-2-yl)cyclobutyl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 90155395 |
| Molecular Formula | C27H31F4N5O3S |
| Molecular Weight | 581.64 g/mol |
| Exact Mass | 581.21 |
| IUPAC Name | 6-(1,3-benzothiazol-6-ylamino)-N-[(2R)-3-cyclopropyl-2,4,4,4-tetrafluoro-3-hydroxybutyl]-4-[[3-(2-hydroxypropan-2-yl)cyclobutyl]amino]pyridine-3-carboxamide |
| SMILES | CC(C)(O)C1CC(Nc2cc(Nc3ccc4ncsc4c3)ncc2C(=O)NC[C@@H](F)C(O)(C2CC2)C(F)(F)F)C1 |
| InChI | InChI=1S/C27H31F4N5O3S/c1-25(2,38)15-7-17(8-15)35-20-10-23(36-16-5-6-19-21(9-16)40-13-34-19)32-11-18(20)24(37)33-12-22(28)26(39,14-3-4-14)27(29,30)31/h5-6,9-11,13-15,17,22,38-39H,3-4,7-8,12H2,1-2H3,(H,33,37)(H2,32,35,36)/t15?,17?,22-,26?/m1/s1 |
| InChIKey | JPBGBWNIHVMXCE-UIBAWOMDSA-N |
| XLogP | 5.17 |
| TPSA | 119.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.64 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |