C22H33BrClNO4Si — CID 90155523
[(3R,3aR,4S,6aS)-1-[(3-bromo-6-chloro-2-methoxyphenyl)methyl]-4-methyl-6-methylidene-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-3-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 90155523) has the molecular formula C22H33BrClNO4Si and a molecular weight of 518.95 g/mol. Its IUPAC name is [(3R,3aR,4S,6aS)-1-[(3-bromo-6-chloro-2-methoxyphenyl)methyl]-4-methyl-6-methylidene-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-3-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(3R,3aR,4S,6aS)-1-[(3-bromo-6-chloro-2-methoxyphenyl)methyl]-4-methyl-6-methylidene-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-3-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 90155523 |
| Molecular Formula | C22H33BrClNO4Si |
| Molecular Weight | 518.95 g/mol |
| Exact Mass | 517.11 |
| IUPAC Name | [(3R,3aR,4S,6aS)-1-[(3-bromo-6-chloro-2-methoxyphenyl)methyl]-4-methyl-6-methylidene-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-3-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | C=C1O[C@@H](C)[C@@H]2[C@H](CO[Si](C)(C)C(C)(C)C)ON(Cc3c(Cl)ccc(Br)c3OC)[C@H]12 |
| InChI | InChI=1S/C22H33BrClNO4Si/c1-13-19-18(12-27-30(7,8)22(3,4)5)29-25(20(19)14(2)28-13)11-15-17(24)10-9-16(23)21(15)26-6/h9-10,13,18-20H,2,11-12H2,1,3-8H3/t13-,18-,19+,20+/m0/s1 |
| InChIKey | LVJZITQAXOZOET-YGHPHNMRSA-N |
| XLogP | 6.17 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.95 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|