About bis(2,2-dimethylpropan-1-olate);tin(2+)
bis(2,2-dimethylpropan-1-olate);tin(2+) (PubChem CID 90155822) has the molecular formula C10H22O2Sn
and a molecular weight of 293.00 g/mol. Its IUPAC name is bis(2,2-dimethylpropan-1-olate);tin(2+).
Molecular Properties
| Compound Name | bis(2,2-dimethylpropan-1-olate);tin(2+) |
| PubChem CID | 90155822 |
| Molecular Formula | C10H22O2Sn |
| Molecular Weight | 293.00 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | bis(2,2-dimethylpropan-1-olate);tin(2+) |
| SMILES | CC(C)(C)C[O-].CC(C)(C)C[O-].[Sn+2] |
| InChI | InChI=1S/2C5H11O.Sn/c2*1-5(2,3)4-6;/h2*4H2,1-3H3;/q2*-1;+2 |
| InChIKey | QQZDQFOVPOGLIF-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.00 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis(2,2-dimethylpropan-1-olate);tin(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2,2-dimethylpropan-1-olate);tin(2+)?
The IUPAC name of bis(2,2-dimethylpropan-1-olate);tin(2+) (CID 90155822) is bis(2,2-dimethylpropan-1-olate);tin(2+).
What is the SMILES notation for bis(2,2-dimethylpropan-1-olate);tin(2+)?
The canonical SMILES for bis(2,2-dimethylpropan-1-olate);tin(2+) is CC(C)(C)C[O-].CC(C)(C)C[O-].[Sn+2].
What is the InChIKey of bis(2,2-dimethylpropan-1-olate);tin(2+)?
The InChIKey is QQZDQFOVPOGLIF-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H11O.Sn/c2*1-5(2,3)4-6;/h2*4H2,1-3H3;/q2*-1;+2.
What are the key properties of bis(2,2-dimethylpropan-1-olate);tin(2+)?
bis(2,2-dimethylpropan-1-olate);tin(2+) has a molecular weight of 293.00 g/mol, XLogP of 0.40, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2,2-dimethylpropan-1-olate);tin(2+) is sourced from PubChem (CID 90155822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).