C8H16FNO — CID 90156152
(3R,4R)-1-tert-butyl-4-fluoropyrrolidin-3-ol (PubChem CID 90156152) has the molecular formula C8H16FNO and a molecular weight of 161.22 g/mol. Its IUPAC name is (3R,4R)-1-tert-butyl-4-fluoropyrrolidin-3-ol.
| Compound Name | (3R,4R)-1-tert-butyl-4-fluoropyrrolidin-3-ol |
|---|---|
| PubChem CID | 90156152 |
| Molecular Formula | C8H16FNO |
| Molecular Weight | 161.22 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | (3R,4R)-1-tert-butyl-4-fluoropyrrolidin-3-ol |
| SMILES | CC(C)(C)N1C[C@@H](O)[C@H](F)C1 |
| InChI | InChI=1S/C8H16FNO/c1-8(2,3)10-4-6(9)7(11)5-10/h6-7,11H,4-5H2,1-3H3/t6-,7-/m1/s1 |
| InChIKey | MWASPZMDGHXHTN-RNFRBKRXSA-N |
| XLogP | 0.80 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.22 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |