About US10351575, Example 42
US10351575, Example 42 (PubChem CID 90156633) has the molecular formula C28H30N6O2
and a molecular weight of 482.60 g/mol. Its IUPAC name is 1-(1-ethyl-3,4-dihydro-2H-quinolin-4-yl)-3-[4-methyl-3-(1-methyl-6-oxo-3-pyridinyl)-1-phenylpyrazol-5-yl]urea.
Molecular Properties
| Compound Name | US10351575, Example 42 |
| PubChem CID | 90156633 |
| Molecular Formula | C28H30N6O2 |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | 1-(1-ethyl-3,4-dihydro-2H-quinolin-4-yl)-3-[4-methyl-3-(1-methyl-6-oxo-3-pyridinyl)-1-phenylpyrazol-5-yl]urea |
| SMILES | CCN1CCC(C2=CC=CC=C21)NC(=O)NC3=C(C(=NN3C4=CC=CC=C4)C5=CN(C(=O)C=C5)C)C |
| InChI | InChI=1S/C28H30N6O2/c1-4-33-17-16-23(22-12-8-9-13-24(22)33)29-28(36)30-27-19(2)26(20-14-15-25(35)32(3)18-20)31-34(27)21-10-6-5-7-11-21/h5-15,18,23H,4,16-17H2,1-3H3,(H2,29,30,36) |
| InChIKey | JUSGTGZMKFQZFF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | 868 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze US10351575, Example 42 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US10351575, Example 42?
The IUPAC name of US10351575, Example 42 (CID 90156633) is 1-(1-ethyl-3,4-dihydro-2H-quinolin-4-yl)-3-[4-methyl-3-(1-methyl-6-oxo-3-pyridinyl)-1-phenylpyrazol-5-yl]urea.
What is the SMILES notation for US10351575, Example 42?
The canonical SMILES for US10351575, Example 42 is CCN1CCC(C2=CC=CC=C21)NC(=O)NC3=C(C(=NN3C4=CC=CC=C4)C5=CN(C(=O)C=C5)C)C.
What is the InChIKey of US10351575, Example 42?
The InChIKey is JUSGTGZMKFQZFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H30N6O2/c1-4-33-17-16-23(22-12-8-9-13-24(22)33)29-28(36)30-27-19(2)26(20-14-15-25(35)32(3)18-20)31-34(27)21-10-6-5-7-11-21/h5-15,18,23H,4,16-17H2,1-3H3,(H2,29,30,36).
What are the key properties of US10351575, Example 42?
US10351575, Example 42 has a molecular weight of 482.60 g/mol, XLogP of 3.40, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for US10351575, Example 42 is sourced from PubChem (CID 90156633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).