About 6,7-difluoro-4,4-dimethyl-2,3-dihydro-1H-naphthalene
6,7-difluoro-4,4-dimethyl-2,3-dihydro-1H-naphthalene (PubChem CID 90156908) has the molecular formula C12H14F2
and a molecular weight of 196.24 g/mol. Its IUPAC name is 6,7-difluoro-4,4-dimethyl-2,3-dihydro-1H-naphthalene.
Molecular Properties
| Compound Name | 6,7-difluoro-4,4-dimethyl-2,3-dihydro-1H-naphthalene |
| PubChem CID | 90156908 |
| Molecular Formula | C12H14F2 |
| Molecular Weight | 196.24 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 6,7-difluoro-4,4-dimethyl-2,3-dihydro-1H-naphthalene |
| SMILES | CC1(C)CCCc2cc(F)c(F)cc21 |
| InChI | InChI=1S/C12H14F2/c1-12(2)5-3-4-8-6-10(13)11(14)7-9(8)12/h6-7H,3-5H2,1-2H3 |
| InChIKey | PCMSOSQAKMLZDE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.24 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 6,7-difluoro-4,4-dimethyl-2,3-dihydro-1H-naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-difluoro-4,4-dimethyl-2,3-dihydro-1H-naphthalene?
The IUPAC name of 6,7-difluoro-4,4-dimethyl-2,3-dihydro-1H-naphthalene (CID 90156908) is 6,7-difluoro-4,4-dimethyl-2,3-dihydro-1H-naphthalene.
What is the SMILES notation for 6,7-difluoro-4,4-dimethyl-2,3-dihydro-1H-naphthalene?
The canonical SMILES for 6,7-difluoro-4,4-dimethyl-2,3-dihydro-1H-naphthalene is CC1(C)CCCc2cc(F)c(F)cc21.
What is the InChIKey of 6,7-difluoro-4,4-dimethyl-2,3-dihydro-1H-naphthalene?
The InChIKey is PCMSOSQAKMLZDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F2/c1-12(2)5-3-4-8-6-10(13)11(14)7-9(8)12/h6-7H,3-5H2,1-2H3.
What are the key properties of 6,7-difluoro-4,4-dimethyl-2,3-dihydro-1H-naphthalene?
6,7-difluoro-4,4-dimethyl-2,3-dihydro-1H-naphthalene has a molecular weight of 196.24 g/mol, XLogP of 3.58, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-difluoro-4,4-dimethyl-2,3-dihydro-1H-naphthalene is sourced from PubChem (CID 90156908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).