C24H22N6O2S — CID 90157090
7'-(3-methoxy-1,7-naphthyridin-8-yl)spiro[5,6-dihydro-1,3-thiazine-4,5'-6H-chromeno[2,3-c]pyridine]-2,7'-diamine (PubChem CID 90157090) has the molecular formula C24H22N6O2S and a molecular weight of 458.55 g/mol. Its IUPAC name is 7'-(3-methoxy-1,7-naphthyridin-8-yl)spiro[5,6-dihydro-1,3-thiazine-4,5'-6H-chromeno[2,3-c]pyridine]-2,7'-diamine.
| Compound Name | 7'-(3-methoxy-1,7-naphthyridin-8-yl)spiro[5,6-dihydro-1,3-thiazine-4,5'-6H-chromeno[2,3-c]pyridine]-2,7'-diamine |
|---|---|
| PubChem CID | 90157090 |
| Molecular Formula | C24H22N6O2S |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 7'-(3-methoxy-1,7-naphthyridin-8-yl)spiro[5,6-dihydro-1,3-thiazine-4,5'-6H-chromeno[2,3-c]pyridine]-2,7'-diamine |
| SMILES | COc1cnc2c(C3(N)C=CC4=C(C3)C3(CCSC(N)=N3)c3ccncc3O4)nccc2c1 |
| InChI | InChI=1S/C24H22N6O2S/c1-31-15-10-14-3-8-28-21(20(14)29-12-15)23(26)5-2-18-17(11-23)24(6-9-33-22(25)30-24)16-4-7-27-13-19(16)32-18/h2-5,7-8,10,12-13H,6,9,11,26H2,1H3,(H2,25,30) |
| InChIKey | NYHYYRWCRXSIHR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 121.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |