C30H21Cl3N4O4 — CID 90157154
2-[[4-[5,6-bis(chloromethyl)-1H-benzimidazol-2-yl]benzoyl]amino]-5-[(4-chlorophenyl)carbamoyl]benzoic acid (PubChem CID 90157154) has the molecular formula C30H21Cl3N4O4 and a molecular weight of 607.88 g/mol. Its IUPAC name is 2-[[4-[5,6-bis(chloromethyl)-1H-benzimidazol-2-yl]benzoyl]amino]-5-[(4-chlorophenyl)carbamoyl]benzoic acid.
| Compound Name | 2-[[4-[5,6-bis(chloromethyl)-1H-benzimidazol-2-yl]benzoyl]amino]-5-[(4-chlorophenyl)carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 90157154 |
| Molecular Formula | C30H21Cl3N4O4 |
| Molecular Weight | 607.88 g/mol |
| Exact Mass | 606.06 |
| IUPAC Name | 2-[[4-[5,6-bis(chloromethyl)-1H-benzimidazol-2-yl]benzoyl]amino]-5-[(4-chlorophenyl)carbamoyl]benzoic acid |
| SMILES | O=C(Nc1ccc(Cl)cc1)c1ccc(NC(=O)c2ccc(-c3nc4cc(CCl)c(CCl)cc4[nH]3)cc2)c(C(=O)O)c1 |
| InChI | InChI=1S/C30H21Cl3N4O4/c31-14-19-12-25-26(13-20(19)15-32)36-27(35-25)16-1-3-17(4-2-16)28(38)37-24-10-5-18(11-23(24)30(40)41)29(39)34-22-8-6-21(33)7-9-22/h1-13H,14-15H2,(H,34,39)(H,35,36)(H,37,38)(H,40,41) |
| InChIKey | GRKBFXPKNJNFLQ-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 124.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.88 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|