C27H39NO8 — CID 90157390
tert-butyl 4-[(Z)-1-hydroxy-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-en-2-yl]-2,2-dimethyl-6-(phenylmethoxymethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 90157390) has the molecular formula C27H39NO8 and a molecular weight of 505.61 g/mol. Its IUPAC name is tert-butyl 4-[(Z)-1-hydroxy-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-en-2-yl]-2,2-dimethyl-6-(phenylmethoxymethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl 4-[(Z)-1-hydroxy-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-en-2-yl]-2,2-dimethyl-6-(phenylmethoxymethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 90157390 |
| Molecular Formula | C27H39NO8 |
| Molecular Weight | 505.61 g/mol |
| Exact Mass | 505.27 |
| IUPAC Name | tert-butyl 4-[(Z)-1-hydroxy-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-en-2-yl]-2,2-dimethyl-6-(phenylmethoxymethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)/C(=C\O)C1C2OC(C)(C)OC2C(COCc2ccccc2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H39NO8/c1-25(2,3)35-23(30)18(14-29)20-22-21(33-27(7,8)34-22)19(28(20)24(31)36-26(4,5)6)16-32-15-17-12-10-9-11-13-17/h9-14,19-22,29H,15-16H2,1-8H3/b18-14- |
| InChIKey | PPRLDTNDLRDFJX-JXAWBTAJSA-N |
| XLogP | 4.49 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.61 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|