C14H28NO3Si- — CID 90157720
[(3aR,4S,6aS)-2,2-dimethyl-5-oxido-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]methyl-tert-butyl-dimethylsilane (PubChem CID 90157720) has the molecular formula C14H28NO3Si- and a molecular weight of 286.47 g/mol. Its IUPAC name is [(3aR,4S,6aS)-2,2-dimethyl-5-oxido-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]methyl-tert-butyl-dimethylsilane.
| Compound Name | [(3aR,4S,6aS)-2,2-dimethyl-5-oxido-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]methyl-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 90157720 |
| Molecular Formula | C14H28NO3Si- |
| Molecular Weight | 286.47 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | [(3aR,4S,6aS)-2,2-dimethyl-5-oxido-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]methyl-tert-butyl-dimethylsilane |
| SMILES | CC1(C)O[C@H]2[C@H](CN([O-])[C@@H]2C[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C14H28NO3Si/c1-13(2,3)19(6,7)9-10-12-11(8-15(10)16)17-14(4,5)18-12/h10-12H,8-9H2,1-7H3/q-1/t10-,11+,12-/m1/s1 |
| InChIKey | FYODWIPHBWSMAI-GRYCIOLGSA-N |
| XLogP | 3.20 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|