C11H14F3NO4 — CID 90157906
1-[(2-methylpropan-2-yl)oxycarbonyl]-4-(trifluoromethyl)-2,5-dihydropyrrole-2-carboxylic acid (PubChem CID 90157906) has the molecular formula C11H14F3NO4 and a molecular weight of 281.23 g/mol. Its IUPAC name is 1-[(2-methylpropan-2-yl)oxycarbonyl]-4-(trifluoromethyl)-2,5-dihydropyrrole-2-carboxylic acid.
| Compound Name | 1-[(2-methylpropan-2-yl)oxycarbonyl]-4-(trifluoromethyl)-2,5-dihydropyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 90157906 |
| Molecular Formula | C11H14F3NO4 |
| Molecular Weight | 281.23 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 1-[(2-methylpropan-2-yl)oxycarbonyl]-4-(trifluoromethyl)-2,5-dihydropyrrole-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N1CC(C(F)(F)F)=CC1C(=O)O |
| InChI | InChI=1S/C11H14F3NO4/c1-10(2,3)19-9(18)15-5-6(11(12,13)14)4-7(15)8(16)17/h4,7H,5H2,1-3H3,(H,16,17) |
| InChIKey | DVSCIIRPHIEGEF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.23 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|